| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C19H13N4FS |
| Smiles | Fc1ccc(/C=N\Nc2c(c(-c3ccccc3)cs3)c3ncn2)cc1 |
| InChI | InChI=1S/C19H13FN4S/c20-15-8-6-13(7-9-15)10-23-24-18-17-16(14-4-2-1-3-5-14)11-25-19(17)22-12-21-18/h1-12H,(H,21,22,24) |
| InChIK | BSHQMYGRFVTZNY-UHFFFAOYSA-N |
| TotalMolweight | 348.404 |
| Molweight | 348.404 |
| MonoisotopicMass | 348.084494 |
| CLogP | 6.4245 |
| CLogS | -7.036 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 263.41 |
| Relative PSA | 0.24779 |
| PolarSurfaceArea | 78.41 |
| Druglikeness | 1.52 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.6 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]-5-phenylthieno[2,3-d]pyrimidin-4-amine