| MolName | N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide |
| MolecularFormula | C26H17N3O3Cl2 |
| Smiles | O=C(CN(c1c2cccc1)c(cccc1)c1C2=O)N/N=C\c1ccc(-c(ccc(Cl)c2)c2Cl)o1 |
| InChI | InChI=1S/C26H17Cl2N3O3/c27-16-9-11-18(21(28)13-16)24-12-10-17(34-24)14-29-30-25(32)15-31-22-7-3-1-5-19(22)26(33)20-6-2-4-8-23(20)31/h1-14H,15H2,(H,30,32) |
| InChIK | BSIWWYHSOBPSKD-UHFFFAOYSA-N |
| TotalMolweight | 490.345 |
| Molweight | 490.345 |
| MonoisotopicMass | 489.064696 |
| CLogP | 6.4588 |
| CLogS | -9.485 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 355.35 |
| Relative PSA | 0.18773 |
| PolarSurfaceArea | 74.91 |
| Druglikeness | 8.1128 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide | 2 - N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-2-(9-oxoacridin-10-yl)acetamide