| MolName | 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide |
| MolecularFormula | C27H19N5OCl2S |
| Smiles | O=C(CSc1nnc(-c(cc2)ccc2Cl)n1-c(cc1)ccc1Cl)N/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C27H19Cl2N5OS/c28-21-10-8-19(9-11-21)26-32-33-27(34(26)23-14-12-22(29)13-15-23)36-17-25(35)31-30-16-20-6-3-5-18-4-1-2-7-24(18)20/h1-16H,17H2,(H,31,35) |
| InChIK | BSKPORMUONSKGK-UHFFFAOYSA-N |
| TotalMolweight | 532.454 |
| Molweight | 532.454 |
| MonoisotopicMass | 531.068734 |
| CLogP | 6.9382 |
| CLogS | -11.494 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 389.92 |
| Relative PSA | 0.21109 |
| PolarSurfaceArea | 97.47 |
| Druglikeness | 5.4489 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide | 2 - 2-[[4,5-bis(4-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-naphthalen-1-ylmethylideneamino]acetamide