| MolName | N,N'-bis[(Z)-2-bicyclo[2.2.1]heptanylmethylideneamino]hexanediamide |
| MolecularFormula | C22H34N4O2 |
| Smiles | O=C(CCCCC(N/N=C\C1C(CC2)CC2C1)=O)N/N=C\C1C(CC2)CC2C1 |
| InChI | InChI=1S/C22H34N4O2/c27-21(25-23-13-19-11-15-5-7-17(19)9-15)3-1-2-4-22(28)26-24-14-20-12-16-6-8-18(20)10-16/h13-20H,1-12H2,(H,25,27)(H,26,28) |
| InChIK | BSLBPCGUEKNUFS-UHFFFAOYSA-N |
| TotalMolweight | 386.538 |
| Molweight | 386.538 |
| MonoisotopicMass | 386.268176 |
| CLogP | 3.3416 |
| CLogS | -5.626 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 307.56 |
| Relative PSA | 0.23417 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | -3.5456 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71429 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 6 |
| Sp3Atoms | 18 |
| Symmetricatoms | 14 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - N,N'-bis[(Z)-2-bicyclo[2.2.1]heptanylmethylideneamino]hexanediamide | 2 - N,N'-bis[(Z)-2-bicyclo[2.2.1]heptanylmethylideneamino]hexanediamide