| MolName | 4-cyano-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-fluorobenzamide |
| MolecularFormula | C27H17N4O2F |
| Smiles | N#Cc(cc1)cc(F)c1C(N/N=C\c(c1ccccc1cc1)c1OCc(cccc1)c1C#N)=O |
| InChI | InChI=1S/C27H17FN4O2/c28-25-13-18(14-29)9-11-23(25)27(33)32-31-16-24-22-8-4-3-5-19(22)10-12-26(24)34-17-21-7-2-1-6-20(21)15-30/h1-13,16H,17H2,(H,32,33) |
| InChIK | BSQGANFYIXITOD-UHFFFAOYSA-N |
| TotalMolweight | 448.456 |
| Molweight | 448.456 |
| MonoisotopicMass | 448.133554 |
| CLogP | 5.5161 |
| CLogS | -8.528 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 354.88 |
| Relative PSA | 0.20607 |
| PolarSurfaceArea | 98.27 |
| Druglikeness | -1.5995 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52941 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-cyano-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-fluorobenzamide | 2 - 4-cyano-N-[(Z)-[2-[(2-cyanophenyl)methoxy]naphthalen-1-yl]methylideneamino]-2-fluorobenzamide