| MolName | N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-nitro-2-piperidin-1-ylsulfonylaniline |
| MolecularFormula | C19H20N4O6S |
| Smiles | [O-][N+](c(cc1)cc(S(N2CCCCC2)(=O)=O)c1N/N=C/c(cc1)cc2c1OCO2)=O |
| InChI | InChI=1S/C19H20N4O6S/c24-23(25)15-5-6-16(19(11-15)30(26,27)22-8-2-1-3-9-22)21-20-12-14-4-7-17-18(10-14)29-13-28-17/h4-7,10-12,21H,1-3,8-9,13H2 |
| InChIK | BTEQHQSMSJUUES-UHFFFAOYSA-N |
| TotalMolweight | 432.456 |
| Molweight | 432.456 |
| MonoisotopicMass | 432.110356 |
| CLogP | 4.2375 |
| CLogS | -4.415 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 307.35 |
| Relative PSA | 0.34332 |
| PolarSurfaceArea | 134.43 |
| Druglikeness | -4.4093 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 3 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-nitro-2-piperidin-1-ylsulfonylaniline | 2 - N-[(E)-1,3-benzodioxol-5-ylmethylideneamino]-4-nitro-2-piperidin-1-ylsulfonylaniline