| MolName | 3-morpholin-4-ylsulfonyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C25H25N3O5S |
| Smiles | O=C(c1cccc(S(N2CCOCC2)(=O)=O)c1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H25N3O5S/c29-25(22-7-4-8-24(17-22)34(30,31)28-13-15-32-16-14-28)27-26-18-20-9-11-23(12-10-20)33-19-21-5-2-1-3-6-21/h1-12,17-18H,13-16,19H2,(H,27,29) |
| InChIK | BTNMPLMBQUFIFT-UHFFFAOYSA-N |
| TotalMolweight | 479.556 |
| Molweight | 479.556 |
| MonoisotopicMass | 479.151492 |
| CLogP | 3.5925 |
| CLogS | -4.268 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 360.93 |
| Relative PSA | 0.2442 |
| PolarSurfaceArea | 105.68 |
| Druglikeness | -8.0535 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64706 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 8 |
| Symmetricatoms | 7 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-morpholin-4-ylsulfonyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]benzamide | 2 - 3-morpholin-4-ylsulfonyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]benzamide