| MolName | N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide |
| MolecularFormula | C13H16N3OF2S |
| Smiles | O=C(C[NH+]1CCSCC1)N/N=C\c(ccc(F)c1)c1F |
| InChI | InChI=1S/C13H15F2N3OS/c14-11-2-1-10(12(15)7-11)8-16-17-13(19)9-18-3-5-20-6-4-18/h1-2,7-8H,3-6,9H2,(H,17,19)/p+1 |
| InChIK | BTYROALLDURIFD-UHFFFAOYSA-O |
| TotalMolweight | 300.352 |
| Molweight | 300.352 |
| MonoisotopicMass | 300.098213 |
| CLogP | -0.4809 |
| CLogS | -3.055 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 237.06 |
| Relative PSA | 0.29988 |
| PolarSurfaceArea | 71.2 |
| Druglikeness | 2.9199 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 20 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 7 |
| Symmetricatoms | 2 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide | 2 - N-[(Z)-(2,4-difluorophenyl)methylideneamino]-2-thiomorpholin-4-ium-4-ylacetamide