| MolName | [4-[(Z)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate |
| MolecularFormula | C23H16N3O3BrS2 |
| Smiles | O=C(CSc1nc(cccc2)c2s1)N/N=C\c(cc1)ccc1OC(c(cccc1)c1Br)=O |
| InChI | InChI=1S/C23H16BrN3O3S2/c24-18-6-2-1-5-17(18)22(29)30-16-11-9-15(10-12-16)13-25-27-21(28)14-31-23-26-19-7-3-4-8-20(19)32-23/h1-13H,14H2,(H,27,28) |
| InChIK | BTYWQJHJOWQMNR-UHFFFAOYSA-N |
| TotalMolweight | 526.434 |
| Molweight | 526.434 |
| MonoisotopicMass | 524.981643 |
| CLogP | 6.072 |
| CLogS | -7.403 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 353.68 |
| Relative PSA | 0.30499 |
| PolarSurfaceArea | 134.19 |
| Druglikeness | 2.673 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate | 2 - [4-[(Z)-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]hydrazinylidene]methyl]phenyl] 2-bromobenzoate