| MolName | 2-(2-nitrophenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C19H14N4O7 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\NC(COc(cccc2)c2[N+]([O-])=O)=O)o1)=O |
| InChI | InChI=1S/C19H14N4O7/c24-19(12-29-18-8-4-3-7-16(18)23(27)28)21-20-11-13-9-10-17(30-13)14-5-1-2-6-15(14)22(25)26/h1-11H,12H2,(H,21,24) |
| InChIK | BUWLXDAHOVXHCL-UHFFFAOYSA-N |
| TotalMolweight | 410.341 |
| Molweight | 410.341 |
| MonoisotopicMass | 410.086251 |
| CLogP | 1.8722 |
| CLogS | -5.881 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 307.54 |
| Relative PSA | 0.39331 |
| PolarSurfaceArea | 155.47 |
| Druglikeness | 1.3395 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | low |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-(2-nitrophenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(2-nitrophenoxy)-N-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]acetamide