| MolName | 4-phenyl-N-[(Z)-[4-[(Z)-[(4-phenylbenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide |
| MolecularFormula | C34H26N4O2 |
| Smiles | O=C(c(cc1)ccc1-c1ccccc1)N/N=C\c1ccc(/C=N\NC(c(cc2)ccc2-c2ccccc2)=O)cc1 |
| InChI | InChI=1S/C34H26N4O2/c39-33(31-19-15-29(16-20-31)27-7-3-1-4-8-27)37-35-23-25-11-13-26(14-12-25)24-36-38-34(40)32-21-17-30(18-22-32)28-9-5-2-6-10-28/h1-24H,(H,37,39)(H,38,40) |
| InChIK | BVPDDJIBHHTVTP-UHFFFAOYSA-N |
| TotalMolweight | 522.606 |
| Molweight | 522.606 |
| MonoisotopicMass | 522.205576 |
| CLogP | 8.062 |
| CLogS | -9.998 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 420.24 |
| Relative PSA | 0.17138 |
| PolarSurfaceArea | 82.92 |
| Druglikeness | 4.4687 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.7 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 25 |
| StereoCon |
Click to Load Molecule:
1 - 4-phenyl-N-[(Z)-[4-[(Z)-[(4-phenylbenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide | 2 - 4-phenyl-N-[(Z)-[4-[(Z)-[(4-phenylbenzoyl)hydrazinylidene]methyl]phenyl]methylideneamino]benzamide