| MolName | N-cyclohexyl-N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide |
| MolecularFormula | C24H34N4O4 |
| Smiles | O=C(CC(N/N=C\c(cc1)ccc1OCC(NC1CCCCC1)=O)=O)NC1CCCCC1 |
| InChI | InChI=1S/C24H34N4O4/c29-22(26-19-7-3-1-4-8-19)15-23(30)28-25-16-18-11-13-21(14-12-18)32-17-24(31)27-20-9-5-2-6-10-20/h11-14,16,19-20H,1-10,15,17H2,(H,26,29)(H,27,31)(H,28,30) |
| InChIK | BVVDIEXHZLSISB-UHFFFAOYSA-N |
| TotalMolweight | 442.558 |
| Molweight | 442.558 |
| MonoisotopicMass | 442.258006 |
| CLogP | 3.0147 |
| CLogS | -5.221 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 358.77 |
| Relative PSA | 0.26482 |
| PolarSurfaceArea | 108.89 |
| Druglikeness | -2.3213 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 15 |
| Symmetricatoms | 6 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-cyclohexyl-N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide | 2 - N-cyclohexyl-N'-[(Z)-[4-[2-(cyclohexylamino)-2-oxoethoxy]phenyl]methylideneamino]propanediamide