| MolName | N-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide |
| MolecularFormula | C22H17N5O4 |
| Smiles | O=C(C(C(c1c2cccc1)=NNC2=O)NC(c1ccccc1)=O)N/N=C\c1ccco1 |
| InChI | InChI=1S/C22H17N5O4/c28-20(14-7-2-1-3-8-14)24-19(22(30)26-23-13-15-9-6-12-31-15)18-16-10-4-5-11-17(16)21(29)27-25-18/h1-13,19H,(H,24,28)(H,26,30)(H,27,29)/t19-/m1/s1 |
| InChIK | BVWSBBGSHFIEBC-LJQANCHMSA-N |
| TotalMolweight | 415.408 |
| Molweight | 415.408 |
| MonoisotopicMass | 415.128055 |
| CLogP | 2.3218 |
| CLogS | -5.559 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 316.83 |
| Relative PSA | 0.34918 |
| PolarSurfaceArea | 125.16 |
| Druglikeness | 6.7671 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45161 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| StereoCenters | 1 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon | racemate |
Click to Load Molecule:
1 - N-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide | 2 - N-[2-[(2Z)-2-(furan-2-ylmethylidene)hydrazinyl]-2-oxo-1-(4-oxo-3H-phthalazin-1-yl)ethyl]benzamide