| MolName | [4-bromo-2-[(Z)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] benzoate |
| MolecularFormula | C25H17N2O3Br |
| Smiles | O=C(c1cccc2ccccc12)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C25H17BrN2O3/c26-20-13-14-23(31-25(30)18-8-2-1-3-9-18)19(15-20)16-27-28-24(29)22-12-6-10-17-7-4-5-11-21(17)22/h1-16H,(H,28,29) |
| InChIK | BWIOKXNJDTZZEA-UHFFFAOYSA-N |
| TotalMolweight | 473.325 |
| Molweight | 473.325 |
| MonoisotopicMass | 472.042254 |
| CLogP | 6.5517 |
| CLogS | -7.631 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 327.73 |
| Relative PSA | 0.18018 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 2.2076 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-(naphthalene-1-carbonylhydrazinylidene)methyl]phenyl] benzoate