| MolName | 3-[(Z)-[[4-(3-bromoanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol |
| MolecularFormula | C20H20N7O2Br |
| Smiles | Oc1cccc(/C=N\Nc2nc(Nc3cccc(Br)c3)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C20H20BrN7O2/c21-15-4-2-5-16(12-15)23-18-24-19(26-20(25-18)28-7-9-30-10-8-28)27-22-13-14-3-1-6-17(29)11-14/h1-6,11-13,29H,7-10H2,(H2,23,24,25,26,27) |
| InChIK | BWJBQDAYFFFTDG-UHFFFAOYSA-N |
| TotalMolweight | 470.33 |
| Molweight | 470.33 |
| MonoisotopicMass | 469.086184 |
| CLogP | 5.8414 |
| CLogS | -5.554 |
| H Acceptors | 9 |
| H Donors | 3 |
| TotalSurfaceArea | 323.56 |
| Relative PSA | 0.29049 |
| PolarSurfaceArea | 107.79 |
| Druglikeness | 1.6053 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-[[4-(3-bromoanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol | 2 - 3-[(Z)-[[4-(3-bromoanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenol