| MolName | 4-chloro-N-[(Z)-(2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]benzamide |
| MolecularFormula | C16H17N4OClS |
| Smiles | O=C(c(cc1)ccc1Cl)N/N=C\c1cnc(N2CCCCC2)s1 |
| InChI | InChI=1S/C16H17ClN4OS/c17-13-6-4-12(5-7-13)15(22)20-19-11-14-10-18-16(23-14)21-8-2-1-3-9-21/h4-7,10-11H,1-3,8-9H2,(H,20,22) |
| InChIK | BXAPMVCILZEKLM-UHFFFAOYSA-N |
| TotalMolweight | 348.857 |
| Molweight | 348.857 |
| MonoisotopicMass | 348.081158 |
| CLogP | 4.3481 |
| CLogS | -5.292 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 262.71 |
| Relative PSA | 0.26984 |
| PolarSurfaceArea | 85.83 |
| Druglikeness | 5.2192 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.69565 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-chloro-N-[(Z)-(2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]benzamide | 2 - 4-chloro-N-[(Z)-(2-piperidin-1-yl-1,3-thiazol-5-yl)methylideneamino]benzamide