| MolName | 3-(2,4-dichlorophenyl)-4-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C17H11N5O2Cl2S |
| Smiles | [O-][N+](c1c(/C=C/C=N\N(C(c(ccc(Cl)c2)c2Cl)=NN2)C2=S)cccc1)=O |
| InChI | InChI=1S/C17H11Cl2N5O2S/c18-12-7-8-13(14(19)10-12)16-21-22-17(27)23(16)20-9-3-5-11-4-1-2-6-15(11)24(25)26/h1-10H,(H,22,27) |
| InChIK | BXSIVYHASISTOX-UHFFFAOYSA-N |
| TotalMolweight | 420.279 |
| Molweight | 420.279 |
| MonoisotopicMass | 419.001049 |
| CLogP | 3.6037 |
| CLogS | -6.675 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 302.73 |
| Relative PSA | 0.3186 |
| PolarSurfaceArea | 117.9 |
| Druglikeness | -1.4918 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-(2,4-dichlorophenyl)-4-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione | 2 - 3-(2,4-dichlorophenyl)-4-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]-1H-1,2,4-triazole-5-thione