| MolName | 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide |
| MolecularFormula | C15H11N6O4ClS |
| Smiles | Nc1nnc(CC(N/N=C\c2ccc(-c(ccc([N+]([O-])=O)c3)c3Cl)o2)=O)s1 |
| InChI | InChI=1S/C15H11ClN6O4S/c16-11-5-8(22(24)25)1-3-10(11)12-4-2-9(26-12)7-18-19-13(23)6-14-20-21-15(17)27-14/h1-5,7H,6H2,(H2,17,21)(H,19,23) |
| InChIK | BYDQDQRUZNWMJW-UHFFFAOYSA-N |
| TotalMolweight | 406.809 |
| Molweight | 406.809 |
| MonoisotopicMass | 406.025101 |
| CLogP | 1.9887 |
| CLogS | -5.625 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 291.27 |
| Relative PSA | 0.47416 |
| PolarSurfaceArea | 180.46 |
| Druglikeness | 2.7514 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 16 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide | 2 - 2-(5-amino-1,3,4-thiadiazol-2-yl)-N-[(Z)-[5-(2-chloro-4-nitrophenyl)furan-2-yl]methylideneamino]acetamide