| MolName | N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]benzenesulfonamide |
| MolecularFormula | C17H13N4O4ClS |
| Smiles | O=C(/C(/N1)=C/c(cc2)ccc2S(N/N=C\c(cc2)ccc2Cl)(=O)=O)NC1=O |
| InChI | InChI=1S/C17H13ClN4O4S/c18-13-5-1-12(2-6-13)10-19-22-27(25,26)14-7-3-11(4-8-14)9-15-16(23)21-17(24)20-15/h1-10,22H,(H2,20,21,23,24) |
| InChIK | BYTNCHBYAHBYQA-UHFFFAOYSA-N |
| TotalMolweight | 404.833 |
| Molweight | 404.833 |
| MonoisotopicMass | 404.034603 |
| CLogP | 2.0918 |
| CLogS | -3.772 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 282.87 |
| Relative PSA | 0.35546 |
| PolarSurfaceArea | 125.11 |
| Druglikeness | 6.6915 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; limit! 5-methylene-imidazolidine-2,4-dione |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]benzenesulfonamide | 2 - N-[(Z)-(4-chlorophenyl)methylideneamino]-4-[(Z)-(2,5-dioxoimidazolidin-4-ylidene)methyl]benzenesulfonamide