| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine |
| MolecularFormula | C21H27N6Cl |
| Smiles | Clc1c(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)c2)cccc1 |
| InChI | InChI=1S/C21H27ClN6/c22-18-10-4-3-9-17(18)16-23-26-19-15-20(27-11-5-1-6-12-27)25-21(24-19)28-13-7-2-8-14-28/h3-4,9-10,15-16H,1-2,5-8,11-14H2,(H,24,25,26) |
| InChIK | BYUJWLAOKMYCRJ-UHFFFAOYSA-N |
| TotalMolweight | 398.94 |
| Molweight | 398.94 |
| MonoisotopicMass | 398.198571 |
| CLogP | 6.622 |
| CLogS | -6.186 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 313.38 |
| Relative PSA | 0.16596 |
| PolarSurfaceArea | 56.65 |
| Druglikeness | 2.8442 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 10 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| BasicNitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2,6-di(piperidin-1-yl)pyrimidin-4-amine