| MolName | N'-[(Z)-thiophen-3-ylmethylideneamino]oxamide |
| MolecularFormula | C7H7N3O2S |
| Smiles | NC(C(N/N=C\c1cscc1)=O)=O |
| InChI | InChI=1S/C7H7N3O2S/c8-6(11)7(12)10-9-3-5-1-2-13-4-5/h1-4H,(H2,8,11)(H,10,12) |
| InChIK | BZFFDZYLIQSVAV-UHFFFAOYSA-N |
| TotalMolweight | 197.218 |
| Molweight | 197.218 |
| MonoisotopicMass | 197.025897 |
| CLogP | -0.1319 |
| CLogS | -2.002 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 149.44 |
| Relative PSA | 0.56665 |
| PolarSurfaceArea | 112.79 |
| Druglikeness | 2.76 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.69231 |
| Fragments | 1 |
| Non HAtoms | 13 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 1 |
| Small Rings | 1 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-thiophen-3-ylmethylideneamino]oxamide | 2 - N'-[(Z)-thiophen-3-ylmethylideneamino]oxamide