| MolName | N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]formamide |
| MolecularFormula | C10H13N3O2S |
| Smiles | O=CN/N=C\c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C10H13N3O2S/c14-8-12-11-7-9-1-2-10(16-9)13-3-5-15-6-4-13/h1-2,7-8H,3-6H2,(H,12,14) |
| InChIK | BZIKFUKESJTPFL-UHFFFAOYSA-N |
| TotalMolweight | 239.298 |
| Molweight | 239.298 |
| MonoisotopicMass | 239.072847 |
| CLogP | 1.1122 |
| CLogS | -2.983 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 186.8 |
| Relative PSA | 0.3743 |
| PolarSurfaceArea | 82.17 |
| Druglikeness | 4.6225 |
| Mutagenic | low |
| Tumorigenic | low |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 5 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]formamide | 2 - N-[(Z)-(5-morpholin-4-ylthiophen-2-yl)methylideneamino]formamide