| MolName | [2-[(Z)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C21H14N2O3BrCl |
| Smiles | O=C(c(cc1)ccc1Br)N/N=C\c(cccc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C21H14BrClN2O3/c22-17-9-5-14(6-10-17)20(26)25-24-13-16-3-1-2-4-19(16)28-21(27)15-7-11-18(23)12-8-15/h1-13H,(H,25,26) |
| InChIK | BZLFYIYYSZBTQG-UHFFFAOYSA-N |
| TotalMolweight | 457.71 |
| Molweight | 457.71 |
| MonoisotopicMass | 455.987631 |
| CLogP | 5.9633 |
| CLogS | -6.761 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 308.55 |
| Relative PSA | 0.19138 |
| PolarSurfaceArea | 67.76 |
| Druglikeness | 2.2516 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [2-[(Z)-[(4-bromobenzoyl)hydrazinylidene]methyl]phenyl] 4-chlorobenzoate