| MolName | (Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-(3-phenoxyphenyl)methanimine |
| MolecularFormula | C28H27N3O |
| Smiles | C(c1cccc2ccccc12)N(CC1)CCN1/N=C\c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H27N3O/c1-2-12-26(13-3-1)32-27-14-6-8-23(20-27)21-29-31-18-16-30(17-19-31)22-25-11-7-10-24-9-4-5-15-28(24)25/h1-15,20-21H,16-19,22H2 |
| InChIK | BZNNICKWRSXYFY-UHFFFAOYSA-N |
| TotalMolweight | 421.542 |
| Molweight | 421.542 |
| MonoisotopicMass | 421.215412 |
| CLogP | 5.609 |
| CLogS | -6.559 |
| H Acceptors | 4 |
| TotalSurfaceArea | 338.04 |
| Relative PSA | 0.084635 |
| PolarSurfaceArea | 28.07 |
| Druglikeness | 6.7996 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-(3-phenoxyphenyl)methanimine | 2 - (Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-1-(3-phenoxyphenyl)methanimine