| MolName | N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C21H27N7O2 |
| Smiles | C1Oc(cc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc2)c2O1 |
| InChI | InChI=1S/C21H27N7O2/c1-3-9-27(10-4-1)20-23-19(24-21(25-20)28-11-5-2-6-12-28)26-22-14-16-7-8-17-18(13-16)30-15-29-17/h7-8,13-14H,1-6,9-12,15H2,(H,23,24,25,26) |
| InChIK | BZVQKLFKXAARIV-UHFFFAOYSA-N |
| TotalMolweight | 409.492 |
| Molweight | 409.492 |
| MonoisotopicMass | 409.222623 |
| CLogP | 6.0399 |
| CLogS | -6.03 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 316.98 |
| Relative PSA | 0.26178 |
| PolarSurfaceArea | 88 |
| Druglikeness | 2.4665 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine