| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C26H20N3O4ClS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C26H20ClN3O4S/c27-21-12-14-22(15-13-21)30-35(32,33)25-11-5-7-20(17-25)26(31)29-28-18-19-6-4-10-24(16-19)34-23-8-2-1-3-9-23/h1-18,30H,(H,29,31) |
| InChIK | BZXRRGGLWASKNF-UHFFFAOYSA-N |
| TotalMolweight | 505.981 |
| Molweight | 505.981 |
| MonoisotopicMass | 505.086304 |
| CLogP | 5.5023 |
| CLogS | -8.087 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 371.97 |
| Relative PSA | 0.23134 |
| PolarSurfaceArea | 105.24 |
| Druglikeness | 1.6494 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62857 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 2 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-(3-phenoxyphenyl)methylideneamino]benzamide