| MolName | 1-N,4-N-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]phthalazine-1,4-diamine |
| MolecularFormula | C30H32N8Cl4 |
| Smiles | ClCCN(CCCl)c1ccc(/C=N\Nc(c2ccccc22)nnc2N/N=C\c(cc2)ccc2N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C30H32Cl4N8/c31-13-17-41(18-14-32)25-9-5-23(6-10-25)21-35-37-29-27-3-1-2-4-28(27)30(40-39-29)38-36-22-24-7-11-26(12-8-24)42(19-15-33)20-16-34/h1-12,21-22H,13-20H2,(H,37,39)(H,38,40) |
| InChIK | CAMLFZBPGVUOEP-UHFFFAOYSA-N |
| TotalMolweight | 646.452 |
| Molweight | 646.452 |
| MonoisotopicMass | 644.1504 |
| CLogP | 10.425 |
| CLogS | -8.968 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 489.7 |
| Relative PSA | 0.15311 |
| PolarSurfaceArea | 81.04 |
| Druglikeness | 5.7789 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.61905 |
| Fragments | 1 |
| Non HAtoms | 42 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 16 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 8 |
| Symmetricatoms | 26 |
| Amines | 2 |
| Aromatic Amines | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-N,4-N-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]phthalazine-1,4-diamine | 2 - 1-N,4-N-bis[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]phthalazine-1,4-diamine