| MolName | (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(3-phenoxyphenyl)methanimine |
| MolecularFormula | C23H22N3OCl |
| Smiles | Clc(cc1)ccc1N(CC1)CCN1/N=C\c1cc(Oc2ccccc2)ccc1 |
| InChI | InChI=1S/C23H22ClN3O/c24-20-9-11-21(12-10-20)26-13-15-27(16-14-26)25-18-19-5-4-8-23(17-19)28-22-6-2-1-3-7-22/h1-12,17-18H,13-16H2 |
| InChIK | CATXEEOUTZJIKR-UHFFFAOYSA-N |
| TotalMolweight | 391.901 |
| Molweight | 391.901 |
| MonoisotopicMass | 391.145139 |
| CLogP | 5.0977 |
| CLogS | -6.211 |
| H Acceptors | 4 |
| TotalSurfaceArea | 305.1 |
| Relative PSA | 0.093773 |
| PolarSurfaceArea | 28.07 |
| Druglikeness | 6.3056 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67857 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 6 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(3-phenoxyphenyl)methanimine | 2 - (Z)-N-[4-(4-chlorophenyl)piperazin-1-yl]-1-(3-phenoxyphenyl)methanimine