| MolName | 4-[(E)-(4-fluorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| MolecularFormula | C10H6N4F4S |
| Smiles | FC(C(N1/N=C/c(cc2)ccc2F)=NNC1=S)(F)F |
| InChI | InChI=1S/C10H6F4N4S/c11-7-3-1-6(2-4-7)5-15-18-8(10(12,13)14)16-17-9(18)19/h1-5H,(H,17,19) |
| InChIK | CBDSEJYDEMLGSQ-UHFFFAOYSA-N |
| TotalMolweight | 290.244 |
| Molweight | 290.244 |
| MonoisotopicMass | 290.024928 |
| CLogP | 2.4616 |
| CLogS | -4.335 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 197.77 |
| Relative PSA | 0.33387 |
| PolarSurfaceArea | 72.08 |
| Druglikeness | -8.0985 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.57895 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(E)-(4-fluorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione | 2 - 4-[(E)-(4-fluorophenyl)methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione