| MolName | 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea |
| MolecularFormula | C11H14N4O2S2 |
| Smiles | O=S(CC1)(C[C@@H]1NC(N/N=C\c1ccncc1)=S)=O |
| InChI | InChI=1S/C11H14N4O2S2/c16-19(17)6-3-10(8-19)14-11(18)15-13-7-9-1-4-12-5-2-9/h1-2,4-5,7,10H,3,6,8H2,(H2,14,15,18)/t10-/m0/s1 |
| InChIK | CBKXCUCWYQIVQI-JTQLQIEISA-N |
| TotalMolweight | 298.39 |
| Molweight | 298.39 |
| MonoisotopicMass | 298.055816 |
| CLogP | 0.2463 |
| CLogS | -2.563 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 221.27 |
| Relative PSA | 0.46088 |
| PolarSurfaceArea | 123.92 |
| Druglikeness | -0.41376 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.68421 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 1 |
| Rotatable Bond | 3 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 6 |
| Symmetricatoms | 3 |
| Aromatic Nitrogens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea | 2 - 1-[(3R)-1,1-dioxothiolan-3-yl]-3-[(Z)-pyridin-4-ylmethylideneamino]thiourea