| MolName | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea |
| MolecularFormula | C24H17N5ClF3S |
| Smiles | FC(c(cc1)cc(NC(N/N=C\c2cn(-c3ccccc3)nc2-c2ccccc2)=S)c1Cl)(F)F |
| InChI | InChI=1S/C24H17ClF3N5S/c25-20-12-11-18(24(26,27)28)13-21(20)30-23(34)31-29-14-17-15-33(19-9-5-2-6-10-19)32-22(17)16-7-3-1-4-8-16/h1-15H,(H2,30,31,34) |
| InChIK | CBLUUYMBEAPIAO-UHFFFAOYSA-N |
| TotalMolweight | 499.947 |
| Molweight | 499.947 |
| MonoisotopicMass | 499.084526 |
| CLogP | 5.9655 |
| CLogS | -7.348 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 365.77 |
| Relative PSA | 0.21945 |
| PolarSurfaceArea | 86.33 |
| Druglikeness | -3.1515 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 2 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea | 2 - 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea