| MolName | 3-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide |
| MolecularFormula | C15H10N4O7 |
| Smiles | [O-][N+](c1cccc(C(N/N=C\c(cc2OCOc2c2)c2[N+]([O-])=O)=O)c1)=O |
| InChI | InChI=1S/C15H10N4O7/c20-15(9-2-1-3-11(4-9)18(21)22)17-16-7-10-5-13-14(26-8-25-13)6-12(10)19(23)24/h1-7H,8H2,(H,17,20) |
| InChIK | CBUQBSFRLVGOKH-UHFFFAOYSA-N |
| TotalMolweight | 358.265 |
| Molweight | 358.265 |
| MonoisotopicMass | 358.054951 |
| CLogP | 1.4698 |
| CLogS | -5.352 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 254.59 |
| Relative PSA | 0.45897 |
| PolarSurfaceArea | 151.56 |
| Druglikeness | -0.92153 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.53846 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 5 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide | 2 - 3-nitro-N-[(Z)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]benzamide