| MolName | [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate |
| MolecularFormula | C31H33N7O2 |
| Smiles | O=C(c1cccc2ccccc12)Oc1ccc(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C31H33N7O2/c39-28(27-13-9-11-24-10-3-4-12-26(24)27)40-25-16-14-23(15-17-25)22-32-36-29-33-30(37-18-5-1-6-19-37)35-31(34-29)38-20-7-2-8-21-38/h3-4,9-17,22H,1-2,5-8,18-21H2,(H,33,34,35,36) |
| InChIK | CCMYAXQJPYFERD-UHFFFAOYSA-N |
| TotalMolweight | 535.65 |
| Molweight | 535.65 |
| MonoisotopicMass | 535.269573 |
| CLogP | 8.5534 |
| CLogS | -8.395 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 418.83 |
| Relative PSA | 0.20538 |
| PolarSurfaceArea | 95.84 |
| Druglikeness | 2.1862 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.525 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 11 |
| Symmetricatoms | 12 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate | 2 - [4-[(Z)-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]hydrazinylidene]methyl]phenyl] naphthalene-1-carboxylate