| MolName | N'-[(Z)-(3-phenoxyphenyl)methylideneamino]oxamide |
| MolecularFormula | C15H13N3O3 |
| Smiles | NC(C(N/N=C\c1cc(Oc2ccccc2)ccc1)=O)=O |
| InChI | InChI=1S/C15H13N3O3/c16-14(19)15(20)18-17-10-11-5-4-8-13(9-11)21-12-6-2-1-3-7-12/h1-10H,(H2,16,19)(H,18,20) |
| InChIK | CCTDRNNJALRNSZ-UHFFFAOYSA-N |
| TotalMolweight | 283.286 |
| Molweight | 283.286 |
| MonoisotopicMass | 283.095692 |
| CLogP | 1.4793 |
| CLogS | -4.399 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 223.26 |
| Relative PSA | 0.33289 |
| PolarSurfaceArea | 93.78 |
| Druglikeness | 2.1618 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N'-[(Z)-(3-phenoxyphenyl)methylideneamino]oxamide | 2 - N'-[(Z)-(3-phenoxyphenyl)methylideneamino]oxamide