| MolName | (Z)-1-(4-bromo-5-piperidin-1-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C12H14N5OBr |
| Smiles | Brc1c(N2CCCCC2)oc(/C=N\n2cnnc2)c1 |
| InChI | InChI=1S/C12H14BrN5O/c13-11-6-10(7-16-18-8-14-15-9-18)19-12(11)17-4-2-1-3-5-17/h6-9H,1-5H2 |
| InChIK | CCWGJOTZCWUXQL-UHFFFAOYSA-N |
| TotalMolweight | 324.181 |
| Molweight | 324.181 |
| MonoisotopicMass | 323.038171 |
| CLogP | 2.3266 |
| CLogS | -6.343 |
| H Acceptors | 6 |
| TotalSurfaceArea | 218.42 |
| Relative PSA | 0.26545 |
| PolarSurfaceArea | 59.45 |
| Druglikeness | -1.8528 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-(4-bromo-5-piperidin-1-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-(4-bromo-5-piperidin-1-ylfuran-2-yl)-N-(1,2,4-triazol-4-yl)methanimine