| MolName | 2,2-diphenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide |
| MolecularFormula | C28H24N2O2 |
| Smiles | O=C(C(c1ccccc1)c1ccccc1)N/N=C\c(cc1)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H24N2O2/c31-28(27(24-12-6-2-7-13-24)25-14-8-3-9-15-25)30-29-20-22-16-18-26(19-17-22)32-21-23-10-4-1-5-11-23/h1-20,27H,21H2,(H,30,31) |
| InChIK | CCXRPALASPLXPK-UHFFFAOYSA-N |
| TotalMolweight | 420.511 |
| Molweight | 420.511 |
| MonoisotopicMass | 420.183778 |
| CLogP | 6.0754 |
| CLogS | -6.176 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 342.77 |
| Relative PSA | 0.13423 |
| PolarSurfaceArea | 50.69 |
| Druglikeness | 4.7645 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.59375 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 12 |
| StereoCon |
Click to Load Molecule:
1 - 2,2-diphenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide | 2 - 2,2-diphenyl-N-[(Z)-(4-phenylmethoxyphenyl)methylideneamino]acetamide