| MolName | N-(4-chlorophenyl)-N'-[(E)-(4-nitrophenyl)methylideneamino]butanediamide |
| MolecularFormula | C17H15N4O4Cl |
| Smiles | [O-][N+](c1ccc(/C=N/NC(CCC(Nc(cc2)ccc2Cl)=O)=O)cc1)=O |
| InChI | InChI=1S/C17H15ClN4O4/c18-13-3-5-14(6-4-13)20-16(23)9-10-17(24)21-19-11-12-1-7-15(8-2-12)22(25)26/h1-8,11H,9-10H2,(H,20,23)(H,21,24) |
| InChIK | CDEMNNJGAOQPFC-UHFFFAOYSA-N |
| TotalMolweight | 374.783 |
| Molweight | 374.783 |
| MonoisotopicMass | 374.078183 |
| CLogP | 2.7371 |
| CLogS | -5.261 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 282.81 |
| Relative PSA | 0.32152 |
| PolarSurfaceArea | 116.38 |
| Druglikeness | -1.4647 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73077 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(4-chlorophenyl)-N'-[(E)-(4-nitrophenyl)methylideneamino]butanediamide | 2 - N-(4-chlorophenyl)-N'-[(E)-(4-nitrophenyl)methylideneamino]butanediamide