| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide |
| MolecularFormula | C24H25N9O4 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c2cc(OCc3ccccc3)ccc2)=O)c1CN1CCOCC1 |
| InChI | InChI=1S/C24H25N9O4/c25-22-23(30-37-29-22)33-20(15-32-9-11-35-12-10-32)21(27-31-33)24(34)28-26-14-18-7-4-8-19(13-18)36-16-17-5-2-1-3-6-17/h1-8,13-14H,9-12,15-16H2,(H2,25,29)(H,28,34) |
| InChIK | CDQMJUVDIBWKJV-UHFFFAOYSA-N |
| TotalMolweight | 503.522 |
| Molweight | 503.522 |
| MonoisotopicMass | 503.202951 |
| CLogP | 2.6894 |
| CLogS | -2.374 |
| H Acceptors | 13 |
| H Donors | 2 |
| TotalSurfaceArea | 388.32 |
| Relative PSA | 0.35973 |
| PolarSurfaceArea | 158.81 |
| Druglikeness | 2.4171 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54054 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 9 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 9 |
| Symmetricatoms | 4 |
| Amines | 1 |
| AlkylAmines | 1 |
| Aromatic Nitrogens | 5 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(morpholin-4-ylmethyl)-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]triazole-4-carboxamide