| MolName | N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| MolecularFormula | C28H32N8O |
| Smiles | C(c1ccccc1)n1c(cccc2)c2c(/C=N\Nc2nc(N3CCOCC3)nc(N3CCCCC3)n2)c1 |
| InChI | InChI=1S/C28H32N8O/c1-3-9-22(10-4-1)20-36-21-23(24-11-5-6-12-25(24)36)19-29-33-26-30-27(34-13-7-2-8-14-34)32-28(31-26)35-15-17-37-18-16-35/h1,3-6,9-12,19,21H,2,7-8,13-18,20H2,(H,30,31,32,33) |
| InChIK | CDWLFEVQCGBULK-UHFFFAOYSA-N |
| TotalMolweight | 496.617 |
| Molweight | 496.617 |
| MonoisotopicMass | 496.269907 |
| CLogP | 6.2942 |
| CLogS | -5.408 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 390.28 |
| Relative PSA | 0.2046 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 1.815 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48649 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 7 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 11 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine | 2 - N-[(Z)-(1-benzylindol-3-yl)methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine