| MolName | [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| MolecularFormula | C18H12N4O7 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\c(cc1)ccc1OC(c1ccco1)=O)=O |
| InChI | InChI=1S/C18H12N4O7/c23-18(17-2-1-9-28-17)29-14-6-3-12(4-7-14)11-19-20-15-8-5-13(21(24)25)10-16(15)22(26)27/h1-11,20H |
| InChIK | CEKYERBLOISCOV-UHFFFAOYSA-N |
| TotalMolweight | 396.314 |
| Molweight | 396.314 |
| MonoisotopicMass | 396.070601 |
| CLogP | 3.6169 |
| CLogS | -5.221 |
| H Acceptors | 11 |
| H Donors | 1 |
| TotalSurfaceArea | 293.78 |
| Relative PSA | 0.41174 |
| PolarSurfaceArea | 155.47 |
| Druglikeness | -2.9038 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| AcidicOxygens | 2 |
| StereoCon |
Click to Load Molecule:
1 - [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate | 2 - [4-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenyl] furan-2-carboxylate