| MolName | 4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid |
| MolecularFormula | C17H11N3O2Cl2S |
| Smiles | OC(c1ccc(/C=N\Nc2nc(-c(ccc(Cl)c3)c3Cl)cs2)cc1)=O |
| InChI | InChI=1S/C17H11Cl2N3O2S/c18-12-5-6-13(14(19)7-12)15-9-25-17(21-15)22-20-8-10-1-3-11(4-2-10)16(23)24/h1-9H,(H,21,22)(H,23,24) |
| InChIK | CEOBBJDZSJPYKL-UHFFFAOYSA-N |
| TotalMolweight | 392.265 |
| Molweight | 392.265 |
| MonoisotopicMass | 390.994901 |
| CLogP | 6.7431 |
| CLogS | -6.145 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 278.64 |
| Relative PSA | 0.28869 |
| PolarSurfaceArea | 102.82 |
| Druglikeness | 3.7497 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid | 2 - 4-[(Z)-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]benzoic acid