| MolName | 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide |
| MolecularFormula | C19H15N4O3ClS |
| Smiles | O=C(c1cccc(S(Nc(cc2)ccc2Cl)(=O)=O)c1)N/N=C\c1ncccc1 |
| InChI | InChI=1S/C19H15ClN4O3S/c20-15-7-9-16(10-8-15)24-28(26,27)18-6-3-4-14(12-18)19(25)23-22-13-17-5-1-2-11-21-17/h1-13,24H,(H,23,25) |
| InChIK | CESQENYXUMWYDS-UHFFFAOYSA-N |
| TotalMolweight | 414.872 |
| Molweight | 414.872 |
| MonoisotopicMass | 414.055338 |
| CLogP | 3.1598 |
| CLogS | -5.019 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 300.97 |
| Relative PSA | 0.28913 |
| PolarSurfaceArea | 108.9 |
| Druglikeness | 1.6744 |
| Mutagenic | low |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.64286 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 1 |
| Symmetricatoms | 3 |
| Amides | 1 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide | 2 - 3-[(4-chlorophenyl)sulfamoyl]-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide