| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-4-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide |
| MolecularFormula | C23H18N4O3Cl2 |
| Smiles | O=C(COc(cc1)ccc1C(N/N=C\c(cccc1)c1Cl)=O)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C23H18Cl2N4O3/c24-20-7-3-1-5-17(20)13-26-28-22(30)15-32-19-11-9-16(10-12-19)23(31)29-27-14-18-6-2-4-8-21(18)25/h1-14H,15H2,(H,28,30)(H,29,31) |
| InChIK | CEVUYNWHCNUXDJ-UHFFFAOYSA-N |
| TotalMolweight | 469.327 |
| Molweight | 469.327 |
| MonoisotopicMass | 468.075595 |
| CLogP | 5.5305 |
| CLogS | -7.078 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 355.32 |
| Relative PSA | 0.23083 |
| PolarSurfaceArea | 92.15 |
| Druglikeness | 4.2278 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-4-[2-[(2Z)-2-[(2-chlorophenyl)methylidene]hydrazinyl]-2-oxoethoxy]benzamide