| MolName | 2-[[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol |
| MolecularFormula | C17H15N3O5S |
| Smiles | OCCN(C(c1c2cccc1)=NS2(=O)=O)/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C17H15N3O5S/c21-8-7-20(17-13-3-1-2-4-16(13)26(22,23)19-17)18-10-12-5-6-14-15(9-12)25-11-24-14/h1-6,9-10,21H,7-8,11H2 |
| InChIK | CFCMMSJJUPEXDU-UHFFFAOYSA-N |
| TotalMolweight | 373.388 |
| Molweight | 373.388 |
| MonoisotopicMass | 373.073242 |
| CLogP | 2.4675 |
| CLogS | -3.726 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 260.26 |
| Relative PSA | 0.33908 |
| PolarSurfaceArea | 109.17 |
| Druglikeness | 4.5716 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 26 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 4 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 7 |
| Symmetricatoms | 1 |
| BasicNitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol | 2 - 2-[[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-(1,1-dioxo-1,2-benzothiazol-3-yl)amino]ethanol