| MolName | N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-4-[(2Z)-2-[(Z)-2-chloro-3-phenylprop-2-enylidene]hydrazinyl]benzamide |
| MolecularFormula | C25H20N4OCl2 |
| Smiles | O=C(c(cc1)ccc1N/N=C\C(\Cl)=C\c1ccccc1)N/N=C\C(\Cl)=C\c1ccccc1 |
| InChI | InChI=1S/C25H20Cl2N4O/c26-22(15-19-7-3-1-4-8-19)17-28-30-24-13-11-21(12-14-24)25(32)31-29-18-23(27)16-20-9-5-2-6-10-20/h1-18,30H,(H,31,32) |
| InChIK | CFEUJCDNAHZPSL-UHFFFAOYSA-N |
| TotalMolweight | 463.367 |
| Molweight | 463.367 |
| MonoisotopicMass | 462.101415 |
| CLogP | 7.3427 |
| CLogS | -7.22 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 363.23 |
| Relative PSA | 0.16238 |
| PolarSurfaceArea | 65.85 |
| Druglikeness | 4.653 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.71875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-4-[(2Z)-2-[(Z)-2-chloro-3-phenylprop-2-enylidene]hydrazinyl]benzamide | 2 - N-[(Z)-[(Z)-2-chloro-3-phenylprop-2-enylidene]amino]-4-[(2Z)-2-[(Z)-2-chloro-3-phenylprop-2-enylidene]hydrazinyl]benzamide