| MolName | 2-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| MolecularFormula | C26H19N7OCl2 |
| Smiles | Clc(cc1)cc(Cl)c1-c1ccc(/C=N\Nc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)o1 |
| InChI | InChI=1S/C26H19Cl2N7O/c27-17-11-13-21(22(28)15-17)23-14-12-20(36-23)16-29-35-26-33-24(30-18-7-3-1-4-8-18)32-25(34-26)31-19-9-5-2-6-10-19/h1-16H,(H3,30,31,32,33,34,35) |
| InChIK | CFHFNTCVDDHXOE-UHFFFAOYSA-N |
| TotalMolweight | 516.391 |
| Molweight | 516.391 |
| MonoisotopicMass | 515.102812 |
| CLogP | 9.4742 |
| CLogS | -9.423 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 388.25 |
| Relative PSA | 0.2393 |
| PolarSurfaceArea | 100.26 |
| Druglikeness | 4.5376 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Symmetricatoms | 11 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine | 2 - 2-N-[(Z)-[5-(2,4-dichlorophenyl)furan-2-yl]methylideneamino]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine