| MolName | N-(3-chloro-4-fluorophenyl)-N'-[(Z)-furan-2-ylmethylideneamino]oxamide |
| MolecularFormula | C13H9N3O3ClF |
| Smiles | O=C(C(N/N=C\c1ccco1)=O)Nc(cc1)cc(Cl)c1F |
| InChI | InChI=1S/C13H9ClFN3O3/c14-10-6-8(3-4-11(10)15)17-12(19)13(20)18-16-7-9-2-1-5-21-9/h1-7H,(H,17,19)(H,18,20) |
| InChIK | CFINHEKBEKKXDW-UHFFFAOYSA-N |
| TotalMolweight | 309.683 |
| Molweight | 309.683 |
| MonoisotopicMass | 309.031647 |
| CLogP | 2.0394 |
| CLogS | -4.257 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 227.66 |
| Relative PSA | 0.32777 |
| PolarSurfaceArea | 83.7 |
| Druglikeness | 2.2147 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde; limit! oxal-diamide |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 21 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-(3-chloro-4-fluorophenyl)-N'-[(Z)-furan-2-ylmethylideneamino]oxamide | 2 - N-(3-chloro-4-fluorophenyl)-N'-[(Z)-furan-2-ylmethylideneamino]oxamide