| MolName | 3-[(Z)-anthracen-9-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| MolecularFormula | C25H19N3OS |
| Smiles | O=C(c1c(N=C2)sc3c1CCCC3)N2/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C25H19N3OS/c29-25-23-20-11-5-6-12-22(20)30-24(23)26-15-28(25)27-14-21-18-9-3-1-7-16(18)13-17-8-2-4-10-19(17)21/h1-4,7-10,13-15H,5-6,11-12H2 |
| InChIK | CFJNEKHGKTVELV-UHFFFAOYSA-N |
| TotalMolweight | 409.512 |
| Molweight | 409.512 |
| MonoisotopicMass | 409.124882 |
| CLogP | 6.0738 |
| CLogS | -8.263 |
| H Acceptors | 4 |
| TotalSurfaceArea | 303.77 |
| Relative PSA | 0.19742 |
| PolarSurfaceArea | 73.27 |
| Druglikeness | 1.3283 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46667 |
| Fragments | 1 |
| Non HAtoms | 30 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 2 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 4 |
| Symmetricatoms | 6 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(Z)-anthracen-9-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one | 2 - 3-[(Z)-anthracen-9-ylmethylideneamino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one