| MolName | 2-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C30H27N8Cl2F |
| Smiles | Fc(cc1)ccc1Nc1nc(N/N=C\c2cn(Cc(ccc(Cl)c3)c3Cl)c3c2cccc3)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C30H27Cl2FN8/c31-22-9-8-20(26(32)16-22)18-41-19-21(25-6-2-3-7-27(25)41)17-34-39-29-36-28(35-24-12-10-23(33)11-13-24)37-30(38-29)40-14-4-1-5-15-40/h2-3,6-13,16-17,19H,1,4-5,14-15,18H2,(H2,35,36,37,38,39) |
| InChIK | CFJQYRAMSVLQAS-UHFFFAOYSA-N |
| TotalMolweight | 589.504 |
| Molweight | 589.504 |
| MonoisotopicMass | 588.171974 |
| CLogP | 9.4684 |
| CLogS | -8.669 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 436.85 |
| Relative PSA | 0.178 |
| PolarSurfaceArea | 83.26 |
| Druglikeness | 1.7759 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.5122 |
| Fragments | 1 |
| Non HAtoms | 41 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 4 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine | 2 - 2-N-[(Z)-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4-N-(4-fluorophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine