| MolName | 4,6-dimorpholin-4-yl-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine |
| MolecularFormula | C22H24N8O5 |
| Smiles | [O-][N+](c1cc(-c2ccc(/C=N/Nc3nc(N4CCOCC4)nc(N4CCOCC4)n3)o2)ccc1)=O |
| InChI | InChI=1S/C22H24N8O5/c31-30(32)17-3-1-2-16(14-17)19-5-4-18(35-19)15-23-27-20-24-21(28-6-10-33-11-7-28)26-22(25-20)29-8-12-34-13-9-29/h1-5,14-15H,6-13H2,(H,24,25,26,27) |
| InChIK | CFOQJUMTPDYPJM-UHFFFAOYSA-N |
| TotalMolweight | 480.484 |
| Molweight | 480.484 |
| MonoisotopicMass | 480.186967 |
| CLogP | 3.1066 |
| CLogS | -5.461 |
| H Acceptors | 13 |
| H Donors | 1 |
| TotalSurfaceArea | 362.32 |
| Relative PSA | 0.35193 |
| PolarSurfaceArea | 146.96 |
| Druglikeness | 0.087166 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51429 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 13 |
| Electronegative Atoms | 13 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 11 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4,6-dimorpholin-4-yl-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine | 2 - 4,6-dimorpholin-4-yl-N-[(E)-[5-(3-nitrophenyl)furan-2-yl]methylideneamino]-1,3,5-triazin-2-amine